C22H6F9N2O+ — CID 20784006
10-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one (PubChem CID 20784006) has the molecular formula C22H6F9N2O+ and a molecular weight of 485.29 g/mol. Its IUPAC name is 10-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one.
| Compound Name | 10-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one |
|---|---|
| PubChem CID | 20784006 |
| Molecular Formula | C22H6F9N2O+ |
| Molecular Weight | 485.29 g/mol |
| Exact Mass | 485.03 |
| IUPAC Name | 10-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one |
| SMILES | O=c1n2ccc3cccc(c[n+]1-c1c(F)c(F)c(-c4c(F)c(F)c(F)c(F)c4F)c(F)c1F)c32 |
| InChI | InChI=1S/C22H6F9N2O/c23-11-9(12(24)16(28)17(29)15(11)27)10-13(25)18(30)21(19(31)14(10)26)33-6-8-3-1-2-7-4-5-32(20(7)8)22(33)34/h1-6H/q+1 |
| InChIKey | KORSBMHNOFAYAN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.29 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|