C17H6F7N2O+ — CID 20784007
10-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one (PubChem CID 20784007) has the molecular formula C17H6F7N2O+ and a molecular weight of 387.23 g/mol. Its IUPAC name is 10-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one.
| Compound Name | 10-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one |
|---|---|
| PubChem CID | 20784007 |
| Molecular Formula | C17H6F7N2O+ |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 10-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one |
| SMILES | O=c1n2ccc3cccc(c[n+]1-c1c(F)c(F)c(C(F)(F)F)c(F)c1F)c32 |
| InChI | InChI=1S/C17H6F7N2O/c18-10-9(17(22,23)24)11(19)13(21)15(12(10)20)26-6-8-3-1-2-7-4-5-25(14(7)8)16(26)27/h1-6H/q+1 |
| InChIKey | FUEFPBXYRNXDII-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|