C16H7F4N2O+ — CID 20784009
10-(2,3,5,6-tetrafluorophenyl)-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one (PubChem CID 20784009) has the molecular formula C16H7F4N2O+ and a molecular weight of 319.24 g/mol. Its IUPAC name is 10-(2,3,5,6-tetrafluorophenyl)-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one.
| Compound Name | 10-(2,3,5,6-tetrafluorophenyl)-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one |
|---|---|
| PubChem CID | 20784009 |
| Molecular Formula | C16H7F4N2O+ |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 10-(2,3,5,6-tetrafluorophenyl)-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one |
| SMILES | O=c1n2ccc3cccc(c[n+]1-c1c(F)c(F)cc(F)c1F)c32 |
| InChI | InChI=1S/C16H7F4N2O/c17-10-6-11(18)13(20)15(12(10)19)22-7-9-3-1-2-8-4-5-21(14(8)9)16(22)23/h1-7H/q+1 |
| InChIKey | KKLVBDGOGDCWLJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|