C17H12N4+2 — CID 20784059
2,21-diaza-8,15-diazoniahexacyclo[13.6.0.01,8.02,6.09,14.017,21]henicosa-3,5,7,9,11,13,15,17,19-nonaene (PubChem CID 20784059) has the molecular formula C17H12N4+2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 2,21-diaza-8,15-diazoniahexacyclo[13.6.0.01,8.02,6.09,14.017,21]henicosa-3,5,7,9,11,13,15,17,19-nonaene.
| Compound Name | 2,21-diaza-8,15-diazoniahexacyclo[13.6.0.01,8.02,6.09,14.017,21]henicosa-3,5,7,9,11,13,15,17,19-nonaene |
|---|---|
| PubChem CID | 20784059 |
| Molecular Formula | C17H12N4+2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2,21-diaza-8,15-diazoniahexacyclo[13.6.0.01,8.02,6.09,14.017,21]henicosa-3,5,7,9,11,13,15,17,19-nonaene |
| SMILES | C1=[N+]2c3ccccc3[N+]3=Cc4cccn4C23n2cccc21 |
| InChI | InChI=1S/C17H12N4/c1-2-8-16-15(7-1)20-11-13-5-3-9-18(13)17(20)19-10-4-6-14(19)12-21(16)17/h1-12H/q+2 |
| InChIKey | KIPBLOXMBGXFJN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 15.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|