C16H10ClN2O+ — CID 20784101
7-chloro-10-phenyl-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one (PubChem CID 20784101) has the molecular formula C16H10ClN2O+ and a molecular weight of 281.72 g/mol. Its IUPAC name is 7-chloro-10-phenyl-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one.
| Compound Name | 7-chloro-10-phenyl-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one |
|---|---|
| PubChem CID | 20784101 |
| Molecular Formula | C16H10ClN2O+ |
| Molecular Weight | 281.72 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 7-chloro-10-phenyl-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one |
| SMILES | O=c1n2ccc3ccc(Cl)c(c[n+]1-c1ccccc1)c32 |
| InChI | InChI=1S/C16H10ClN2O/c17-14-7-6-11-8-9-18-15(11)13(14)10-19(16(18)20)12-4-2-1-3-5-12/h1-10H/q+1 |
| InChIKey | YUUKCHIOXSTIJF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.72 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|