About 2,4-diphenylbenzo[h][1,2,4]benzotriazin-4-ium-3-one
2,4-diphenylbenzo[h][1,2,4]benzotriazin-4-ium-3-one (PubChem CID 20784126) has the molecular formula C23H16N3O+
and a molecular weight of 350.40 g/mol. Its IUPAC name is 2,4-diphenylbenzo[h][1,2,4]benzotriazin-4-ium-3-one.
Molecular Properties
| Compound Name | 2,4-diphenylbenzo[h][1,2,4]benzotriazin-4-ium-3-one |
| PubChem CID | 20784126 |
| Molecular Formula | C23H16N3O+ |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2,4-diphenylbenzo[h][1,2,4]benzotriazin-4-ium-3-one |
| SMILES | O=c1n(-c2ccccc2)nc2c3ccccc3ccc2[n+]1-c1ccccc1 |
| InChI | InChI=1S/C23H16N3O/c27-23-25(18-10-3-1-4-11-18)21-16-15-17-9-7-8-14-20(17)22(21)24-26(23)19-12-5-2-6-13-19/h1-16H/q+1 |
| InChIKey | HSCFTZZUQJMPEB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diphenylbenzo[h][1,2,4]benzotriazin-4-ium-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diphenylbenzo[h][1,2,4]benzotriazin-4-ium-3-one?
The IUPAC name of 2,4-diphenylbenzo[h][1,2,4]benzotriazin-4-ium-3-one (CID 20784126) is 2,4-diphenylbenzo[h][1,2,4]benzotriazin-4-ium-3-one.
What is the SMILES notation for 2,4-diphenylbenzo[h][1,2,4]benzotriazin-4-ium-3-one?
The canonical SMILES for 2,4-diphenylbenzo[h][1,2,4]benzotriazin-4-ium-3-one is O=c1n(-c2ccccc2)nc2c3ccccc3ccc2[n+]1-c1ccccc1.
What is the InChIKey of 2,4-diphenylbenzo[h][1,2,4]benzotriazin-4-ium-3-one?
The InChIKey is HSCFTZZUQJMPEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N3O/c27-23-25(18-10-3-1-4-11-18)21-16-15-17-9-7-8-14-20(17)22(21)24-26(23)19-12-5-2-6-13-19/h1-16H/q+1.
What are the key properties of 2,4-diphenylbenzo[h][1,2,4]benzotriazin-4-ium-3-one?
2,4-diphenylbenzo[h][1,2,4]benzotriazin-4-ium-3-one has a molecular weight of 350.40 g/mol, XLogP of 3.82, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diphenylbenzo[h][1,2,4]benzotriazin-4-ium-3-one is sourced from PubChem (CID 20784126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).