About 4-(2H-1,3-benzoxazin-3-ium-3-yl)-N,N-dimethylaniline
4-(2H-1,3-benzoxazin-3-ium-3-yl)-N,N-dimethylaniline (PubChem CID 20784353) has the molecular formula C16H17N2O+
and a molecular weight of 253.33 g/mol. Its IUPAC name is 4-(2H-1,3-benzoxazin-3-ium-3-yl)-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-(2H-1,3-benzoxazin-3-ium-3-yl)-N,N-dimethylaniline |
| PubChem CID | 20784353 |
| Molecular Formula | C16H17N2O+ |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 4-(2H-1,3-benzoxazin-3-ium-3-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc([N+]2=Cc3ccccc3OC2)cc1 |
| InChI | InChI=1S/C16H17N2O/c1-17(2)14-7-9-15(10-8-14)18-11-13-5-3-4-6-16(13)19-12-18/h3-11H,12H2,1-2H3/q+1 |
| InChIKey | DUBYHGGQEXRUIT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(2H-1,3-benzoxazin-3-ium-3-yl)-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2H-1,3-benzoxazin-3-ium-3-yl)-N,N-dimethylaniline?
The IUPAC name of 4-(2H-1,3-benzoxazin-3-ium-3-yl)-N,N-dimethylaniline (CID 20784353) is 4-(2H-1,3-benzoxazin-3-ium-3-yl)-N,N-dimethylaniline.
What is the SMILES notation for 4-(2H-1,3-benzoxazin-3-ium-3-yl)-N,N-dimethylaniline?
The canonical SMILES for 4-(2H-1,3-benzoxazin-3-ium-3-yl)-N,N-dimethylaniline is CN(C)c1ccc([N+]2=Cc3ccccc3OC2)cc1.
What is the InChIKey of 4-(2H-1,3-benzoxazin-3-ium-3-yl)-N,N-dimethylaniline?
The InChIKey is DUBYHGGQEXRUIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N2O/c1-17(2)14-7-9-15(10-8-14)18-11-13-5-3-4-6-16(13)19-12-18/h3-11H,12H2,1-2H3/q+1.
What are the key properties of 4-(2H-1,3-benzoxazin-3-ium-3-yl)-N,N-dimethylaniline?
4-(2H-1,3-benzoxazin-3-ium-3-yl)-N,N-dimethylaniline has a molecular weight of 253.33 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2H-1,3-benzoxazin-3-ium-3-yl)-N,N-dimethylaniline is sourced from PubChem (CID 20784353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).