About 2-(5-methoxy-1-methylindol-3-yl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridine-4-carboxamide
2-(5-methoxy-1-methylindol-3-yl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridine-4-carboxamide (PubChem CID 20784517) has the molecular formula C20H20N4O2
and a molecular weight of 348.41 g/mol. Its IUPAC name is 2-(5-methoxy-1-methylindol-3-yl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridine-4-carboxamide.
Molecular Properties
| Compound Name | 2-(5-methoxy-1-methylindol-3-yl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridine-4-carboxamide |
| PubChem CID | 20784517 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2-(5-methoxy-1-methylindol-3-yl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridine-4-carboxamide |
| SMILES | COc1ccc2c(c1)c(-c1cc3c(C(=O)N(C)C)ccnc3[nH]1)cn2C |
| InChI | InChI=1S/C20H20N4O2/c1-23(2)20(25)13-7-8-21-19-15(13)10-17(22-19)16-11-24(3)18-6-5-12(26-4)9-14(16)18/h5-11H,1-4H3,(H,21,22) |
| InChIKey | BGLVWYSVNHMBAS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 63.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-methoxy-1-methylindol-3-yl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methoxy-1-methylindol-3-yl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridine-4-carboxamide?
The IUPAC name of 2-(5-methoxy-1-methylindol-3-yl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridine-4-carboxamide (CID 20784517) is 2-(5-methoxy-1-methylindol-3-yl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridine-4-carboxamide.
What is the SMILES notation for 2-(5-methoxy-1-methylindol-3-yl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridine-4-carboxamide?
The canonical SMILES for 2-(5-methoxy-1-methylindol-3-yl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridine-4-carboxamide is COc1ccc2c(c1)c(-c1cc3c(C(=O)N(C)C)ccnc3[nH]1)cn2C.
What is the InChIKey of 2-(5-methoxy-1-methylindol-3-yl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridine-4-carboxamide?
The InChIKey is BGLVWYSVNHMBAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N4O2/c1-23(2)20(25)13-7-8-21-19-15(13)10-17(22-19)16-11-24(3)18-6-5-12(26-4)9-14(16)18/h5-11H,1-4H3,(H,21,22).
What are the key properties of 2-(5-methoxy-1-methylindol-3-yl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridine-4-carboxamide?
2-(5-methoxy-1-methylindol-3-yl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridine-4-carboxamide has a molecular weight of 348.41 g/mol, XLogP of 3.43, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methoxy-1-methylindol-3-yl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridine-4-carboxamide is sourced from PubChem (CID 20784517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).