About N-[(1R,2R)-2-methylcyclohexyl]-2-(4-nitrophenyl)sulfanylacetamide
N-[(1R,2R)-2-methylcyclohexyl]-2-(4-nitrophenyl)sulfanylacetamide (PubChem CID 2078452) has the molecular formula C15H20N2O3S
and a molecular weight of 308.40 g/mol. Its IUPAC name is N-[(1R,2R)-2-methylcyclohexyl]-2-(4-nitrophenyl)sulfanylacetamide.
Molecular Properties
| Compound Name | N-[(1R,2R)-2-methylcyclohexyl]-2-(4-nitrophenyl)sulfanylacetamide |
| PubChem CID | 2078452 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-[(1R,2R)-2-methylcyclohexyl]-2-(4-nitrophenyl)sulfanylacetamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)CSc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H20N2O3S/c1-11-4-2-3-5-14(11)16-15(18)10-21-13-8-6-12(7-9-13)17(19)20/h6-9,11,14H,2-5,10H2,1H3,(H,16,18)/t11-,14-/m1/s1 |
| InChIKey | WKMQHYZKULFPJS-BXUZGUMPSA-N |
| XLogP | 3.38 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(1R,2R)-2-methylcyclohexyl]-2-(4-nitrophenyl)sulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2R)-2-methylcyclohexyl]-2-(4-nitrophenyl)sulfanylacetamide?
The IUPAC name of N-[(1R,2R)-2-methylcyclohexyl]-2-(4-nitrophenyl)sulfanylacetamide (CID 2078452) is N-[(1R,2R)-2-methylcyclohexyl]-2-(4-nitrophenyl)sulfanylacetamide.
What is the SMILES notation for N-[(1R,2R)-2-methylcyclohexyl]-2-(4-nitrophenyl)sulfanylacetamide?
The canonical SMILES for N-[(1R,2R)-2-methylcyclohexyl]-2-(4-nitrophenyl)sulfanylacetamide is C[C@@H]1CCCC[C@H]1NC(=O)CSc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of N-[(1R,2R)-2-methylcyclohexyl]-2-(4-nitrophenyl)sulfanylacetamide?
The InChIKey is WKMQHYZKULFPJS-BXUZGUMPSA-N. The full InChI is InChI=1S/C15H20N2O3S/c1-11-4-2-3-5-14(11)16-15(18)10-21-13-8-6-12(7-9-13)17(19)20/h6-9,11,14H,2-5,10H2,1H3,(H,16,18)/t11-,14-/m1/s1.
What are the key properties of N-[(1R,2R)-2-methylcyclohexyl]-2-(4-nitrophenyl)sulfanylacetamide?
N-[(1R,2R)-2-methylcyclohexyl]-2-(4-nitrophenyl)sulfanylacetamide has a molecular weight of 308.40 g/mol, XLogP of 3.38, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2R)-2-methylcyclohexyl]-2-(4-nitrophenyl)sulfanylacetamide is sourced from PubChem (CID 2078452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).