About ethyl 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylate
ethyl 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylate (PubChem CID 20784929) has the molecular formula C9H12N2O3
and a molecular weight of 196.21 g/mol. Its IUPAC name is ethyl 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylate.
Analyze ethyl 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylate?
The IUPAC name of ethyl 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylate (CID 20784929) is ethyl 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylate.
What is the SMILES notation for ethyl 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylate?
The canonical SMILES for ethyl 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylate is CCOC(=O)c1n[nH]c2c1COCC2.
What is the InChIKey of ethyl 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylate?
The InChIKey is NIQZAUPMNUPTMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c1-2-14-9(12)8-6-5-13-4-3-7(6)10-11-8/h2-5H2,1H3,(H,10,11).
What are the key properties of ethyl 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylate?
ethyl 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylate has a molecular weight of 196.21 g/mol, XLogP of 0.66, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxylate is sourced from PubChem (CID 20784929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).