C19H31FN2OSi — CID 20785349
tert-butyl-[1-(4-fluoro-3-piperazin-1-ylphenyl)cyclopropyl]oxy-dimethylsilane (PubChem CID 20785349) has the molecular formula C19H31FN2OSi and a molecular weight of 350.55 g/mol. Its IUPAC name is tert-butyl-[1-(4-fluoro-3-piperazin-1-ylphenyl)cyclopropyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[1-(4-fluoro-3-piperazin-1-ylphenyl)cyclopropyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 20785349 |
| Molecular Formula | C19H31FN2OSi |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | tert-butyl-[1-(4-fluoro-3-piperazin-1-ylphenyl)cyclopropyl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1(c2ccc(F)c(N3CCNCC3)c2)CC1 |
| InChI | InChI=1S/C19H31FN2OSi/c1-18(2,3)24(4,5)23-19(8-9-19)15-6-7-16(20)17(14-15)22-12-10-21-11-13-22/h6-7,14,21H,8-13H2,1-5H3 |
| InChIKey | MGUJNDZSWXPDTD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|