About 7-fluoro-2,6-dimethyl-1,3-benzoxazole
7-fluoro-2,6-dimethyl-1,3-benzoxazole (PubChem CID 20785549) has the molecular formula C9H8FNO
and a molecular weight of 165.17 g/mol. Its IUPAC name is 7-fluoro-2,6-dimethyl-1,3-benzoxazole.
Molecular Properties
| Compound Name | 7-fluoro-2,6-dimethyl-1,3-benzoxazole |
| PubChem CID | 20785549 |
| Molecular Formula | C9H8FNO |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 7-fluoro-2,6-dimethyl-1,3-benzoxazole |
| SMILES | Cc1nc2ccc(C)c(F)c2o1 |
| InChI | InChI=1S/C9H8FNO/c1-5-3-4-7-9(8(5)10)12-6(2)11-7/h3-4H,1-2H3 |
| InChIKey | RIBYQDBYGFVTEB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-fluoro-2,6-dimethyl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2,6-dimethyl-1,3-benzoxazole?
The IUPAC name of 7-fluoro-2,6-dimethyl-1,3-benzoxazole (CID 20785549) is 7-fluoro-2,6-dimethyl-1,3-benzoxazole.
What is the SMILES notation for 7-fluoro-2,6-dimethyl-1,3-benzoxazole?
The canonical SMILES for 7-fluoro-2,6-dimethyl-1,3-benzoxazole is Cc1nc2ccc(C)c(F)c2o1.
What is the InChIKey of 7-fluoro-2,6-dimethyl-1,3-benzoxazole?
The InChIKey is RIBYQDBYGFVTEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FNO/c1-5-3-4-7-9(8(5)10)12-6(2)11-7/h3-4H,1-2H3.
What are the key properties of 7-fluoro-2,6-dimethyl-1,3-benzoxazole?
7-fluoro-2,6-dimethyl-1,3-benzoxazole has a molecular weight of 165.17 g/mol, XLogP of 2.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2,6-dimethyl-1,3-benzoxazole is sourced from PubChem (CID 20785549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).