About 1-propan-2-yl-4,5-dihydrotriazin-6-one
1-propan-2-yl-4,5-dihydrotriazin-6-one (PubChem CID 20785820) has the molecular formula C6H11N3O
and a molecular weight of 141.17 g/mol. Its IUPAC name is 1-propan-2-yl-4,5-dihydrotriazin-6-one.
Molecular Properties
| Compound Name | 1-propan-2-yl-4,5-dihydrotriazin-6-one |
| PubChem CID | 20785820 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | 1-propan-2-yl-4,5-dihydrotriazin-6-one |
| SMILES | CC(C)N1N=NCCC1=O |
| InChI | InChI=1S/C6H11N3O/c1-5(2)9-6(10)3-4-7-8-9/h5H,3-4H2,1-2H3 |
| InChIKey | BKEPGGGPDYKLMM-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-propan-2-yl-4,5-dihydrotriazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yl-4,5-dihydrotriazin-6-one?
The IUPAC name of 1-propan-2-yl-4,5-dihydrotriazin-6-one (CID 20785820) is 1-propan-2-yl-4,5-dihydrotriazin-6-one.
What is the SMILES notation for 1-propan-2-yl-4,5-dihydrotriazin-6-one?
The canonical SMILES for 1-propan-2-yl-4,5-dihydrotriazin-6-one is CC(C)N1N=NCCC1=O.
What is the InChIKey of 1-propan-2-yl-4,5-dihydrotriazin-6-one?
The InChIKey is BKEPGGGPDYKLMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O/c1-5(2)9-6(10)3-4-7-8-9/h5H,3-4H2,1-2H3.
What are the key properties of 1-propan-2-yl-4,5-dihydrotriazin-6-one?
1-propan-2-yl-4,5-dihydrotriazin-6-one has a molecular weight of 141.17 g/mol, XLogP of 0.99, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yl-4,5-dihydrotriazin-6-one is sourced from PubChem (CID 20785820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).