C22H26N8O — CID 20785858
4-[[[4-amino-6-(cyclopentylamino)-1,3,5-triazin-2-yl]amino]methyl]-N-(2-aminophenyl)benzamide (PubChem CID 20785858) has the molecular formula C22H26N8O and a molecular weight of 418.51 g/mol. Its IUPAC name is 4-[[[4-amino-6-(cyclopentylamino)-1,3,5-triazin-2-yl]amino]methyl]-N-(2-aminophenyl)benzamide.
| Compound Name | 4-[[[4-amino-6-(cyclopentylamino)-1,3,5-triazin-2-yl]amino]methyl]-N-(2-aminophenyl)benzamide |
|---|---|
| PubChem CID | 20785858 |
| Molecular Formula | C22H26N8O |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 4-[[[4-amino-6-(cyclopentylamino)-1,3,5-triazin-2-yl]amino]methyl]-N-(2-aminophenyl)benzamide |
| SMILES | Nc1nc(NCc2ccc(C(=O)Nc3ccccc3N)cc2)nc(NC2CCCC2)n1 |
| InChI | InChI=1S/C22H26N8O/c23-17-7-3-4-8-18(17)27-19(31)15-11-9-14(10-12-15)13-25-21-28-20(24)29-22(30-21)26-16-5-1-2-6-16/h3-4,7-12,16H,1-2,5-6,13,23H2,(H,27,31)(H4,24,25,26,28,29,30) |
| InChIKey | SKZIIQNJKUDXEX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 143.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|