C25H24N8O — CID 20785861
4-[[[4-amino-6-(2,3-dihydroindol-1-yl)-1,3,5-triazin-2-yl]amino]methyl]-N-(2-aminophenyl)benzamide (PubChem CID 20785861) has the molecular formula C25H24N8O and a molecular weight of 452.52 g/mol. Its IUPAC name is 4-[[[4-amino-6-(2,3-dihydroindol-1-yl)-1,3,5-triazin-2-yl]amino]methyl]-N-(2-aminophenyl)benzamide.
| Compound Name | 4-[[[4-amino-6-(2,3-dihydroindol-1-yl)-1,3,5-triazin-2-yl]amino]methyl]-N-(2-aminophenyl)benzamide |
|---|---|
| PubChem CID | 20785861 |
| Molecular Formula | C25H24N8O |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 4-[[[4-amino-6-(2,3-dihydroindol-1-yl)-1,3,5-triazin-2-yl]amino]methyl]-N-(2-aminophenyl)benzamide |
| SMILES | Nc1nc(NCc2ccc(C(=O)Nc3ccccc3N)cc2)nc(N2CCc3ccccc32)n1 |
| InChI | InChI=1S/C25H24N8O/c26-19-6-2-3-7-20(19)29-22(34)18-11-9-16(10-12-18)15-28-24-30-23(27)31-25(32-24)33-14-13-17-5-1-4-8-21(17)33/h1-12H,13-15,26H2,(H,29,34)(H3,27,28,30,31,32) |
| InChIKey | NMNOHYVIIQFMLC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 135.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|