C25H26N8O — CID 20785863
N-(2-aminophenyl)-4-[[[4-amino-6-(2-phenylethylamino)-1,3,5-triazin-2-yl]amino]methyl]benzamide (PubChem CID 20785863) has the molecular formula C25H26N8O and a molecular weight of 454.54 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[[4-amino-6-(2-phenylethylamino)-1,3,5-triazin-2-yl]amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[[4-amino-6-(2-phenylethylamino)-1,3,5-triazin-2-yl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 20785863 |
| Molecular Formula | C25H26N8O |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | N-(2-aminophenyl)-4-[[[4-amino-6-(2-phenylethylamino)-1,3,5-triazin-2-yl]amino]methyl]benzamide |
| SMILES | Nc1nc(NCCc2ccccc2)nc(NCc2ccc(C(=O)Nc3ccccc3N)cc2)n1 |
| InChI | InChI=1S/C25H26N8O/c26-20-8-4-5-9-21(20)30-22(34)19-12-10-18(11-13-19)16-29-25-32-23(27)31-24(33-25)28-15-14-17-6-2-1-3-7-17/h1-13H,14-16,26H2,(H,30,34)(H4,27,28,29,31,32,33) |
| InChIKey | UAILMHCJUQOMGV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 143.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|