C12H19NO — CID 20786849
(1R,4R,8R,9S)-9-methyl-3-azatricyclo[6.2.2.04,9]dodecan-2-one (PubChem CID 20786849) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (1R,4R,8R,9S)-9-methyl-3-azatricyclo[6.2.2.04,9]dodecan-2-one.
| Compound Name | (1R,4R,8R,9S)-9-methyl-3-azatricyclo[6.2.2.04,9]dodecan-2-one |
|---|---|
| PubChem CID | 20786849 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (1R,4R,8R,9S)-9-methyl-3-azatricyclo[6.2.2.04,9]dodecan-2-one |
| SMILES | C[C@]12C[C@H]3CC[C@H]1CCC[C@H]2NC3=O |
| InChI | InChI=1S/C12H19NO/c1-12-7-8-5-6-9(12)3-2-4-10(12)13-11(8)14/h8-10H,2-7H2,1H3,(H,13,14)/t8-,9-,10-,12+/m1/s1 |
| InChIKey | DNCSKEBSCIXBNI-BFLSOPEQSA-N |
| XLogP | 2.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |