C15H15Cl2NO2 — CID 20787389
1-(3-chlorophenyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrochloride (PubChem CID 20787389) has the molecular formula C15H15Cl2NO2 and a molecular weight of 312.20 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrochloride.
| Compound Name | 1-(3-chlorophenyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrochloride |
|---|---|
| PubChem CID | 20787389 |
| Molecular Formula | C15H15Cl2NO2 |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 1-(3-chlorophenyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrochloride |
| SMILES | Cl.Oc1cc2c(cc1O)C(c1cccc(Cl)c1)NCC2 |
| InChI | InChI=1S/C15H14ClNO2.ClH/c16-11-3-1-2-10(6-11)15-12-8-14(19)13(18)7-9(12)4-5-17-15;/h1-3,6-8,15,17-19H,4-5H2;1H |
| InChIKey | OKRNJKSERHERDK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|