C10H11N3O5 — CID 20787414
1-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]pyrrolidine-2-carboxylic acid (PubChem CID 20787414) has the molecular formula C10H11N3O5 and a molecular weight of 253.21 g/mol. Its IUPAC name is 1-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 20787414 |
| Molecular Formula | C10H11N3O5 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 1-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C1NC(=O)C(=CN2CCCC2C(=O)O)C(=O)N1 |
| InChI | InChI=1S/C10H11N3O5/c14-7-5(8(15)12-10(18)11-7)4-13-3-1-2-6(13)9(16)17/h4,6H,1-3H2,(H,16,17)(H2,11,12,14,15,18) |
| InChIKey | IFLMOVONCRBDRZ-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|