C19H18N4O4 — CID 2078821
(8aS)-8a-(nitromethyl)-1,3-diphenyl-7,8-dihydro-6H-pyrrolo[1,2-a][1,3,5]triazine-2,4-dione (PubChem CID 2078821) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is (8aS)-8a-(nitromethyl)-1,3-diphenyl-7,8-dihydro-6H-pyrrolo[1,2-a][1,3,5]triazine-2,4-dione.
| Compound Name | (8aS)-8a-(nitromethyl)-1,3-diphenyl-7,8-dihydro-6H-pyrrolo[1,2-a][1,3,5]triazine-2,4-dione |
|---|---|
| PubChem CID | 2078821 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | (8aS)-8a-(nitromethyl)-1,3-diphenyl-7,8-dihydro-6H-pyrrolo[1,2-a][1,3,5]triazine-2,4-dione |
| SMILES | O=C1N(c2ccccc2)C(=O)N(c2ccccc2)[C@]2(C[N+](=O)[O-])CCCN12 |
| InChI | InChI=1S/C19H18N4O4/c24-17-20-13-7-12-19(20,14-21(26)27)23(16-10-5-2-6-11-16)18(25)22(17)15-8-3-1-4-9-15/h1-6,8-11H,7,12-14H2/t19-/m0/s1 |
| InChIKey | DSIREJZCGFYRQC-IBGZPJMESA-N |
| XLogP | 3.32 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|