About 2-(2-amino-4-methoxycarbonyl-1,3-thiazol-5-yl)acetic acid;hydrobromide
2-(2-amino-4-methoxycarbonyl-1,3-thiazol-5-yl)acetic acid;hydrobromide (PubChem CID 20788300) has the molecular formula C7H9BrN2O4S
and a molecular weight of 297.13 g/mol. Its IUPAC name is 2-(2-amino-4-methoxycarbonyl-1,3-thiazol-5-yl)acetic acid;hydrobromide.
Molecular Properties
| Compound Name | 2-(2-amino-4-methoxycarbonyl-1,3-thiazol-5-yl)acetic acid;hydrobromide |
| PubChem CID | 20788300 |
| Molecular Formula | C7H9BrN2O4S |
| Molecular Weight | 297.13 g/mol |
| Exact Mass | 295.95 |
| IUPAC Name | 2-(2-amino-4-methoxycarbonyl-1,3-thiazol-5-yl)acetic acid;hydrobromide |
| SMILES | Br.COC(=O)c1nc(N)sc1CC(=O)O |
| InChI | InChI=1S/C7H8N2O4S.BrH/c1-13-6(12)5-3(2-4(10)11)14-7(8)9-5;/h2H2,1H3,(H2,8,9)(H,10,11);1H |
| InChIKey | IOHRBLAPZJZTBB-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.13 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2-amino-4-methoxycarbonyl-1,3-thiazol-5-yl)acetic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-4-methoxycarbonyl-1,3-thiazol-5-yl)acetic acid;hydrobromide?
The IUPAC name of 2-(2-amino-4-methoxycarbonyl-1,3-thiazol-5-yl)acetic acid;hydrobromide (CID 20788300) is 2-(2-amino-4-methoxycarbonyl-1,3-thiazol-5-yl)acetic acid;hydrobromide.
What is the SMILES notation for 2-(2-amino-4-methoxycarbonyl-1,3-thiazol-5-yl)acetic acid;hydrobromide?
The canonical SMILES for 2-(2-amino-4-methoxycarbonyl-1,3-thiazol-5-yl)acetic acid;hydrobromide is Br.COC(=O)c1nc(N)sc1CC(=O)O.
What is the InChIKey of 2-(2-amino-4-methoxycarbonyl-1,3-thiazol-5-yl)acetic acid;hydrobromide?
The InChIKey is IOHRBLAPZJZTBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O4S.BrH/c1-13-6(12)5-3(2-4(10)11)14-7(8)9-5;/h2H2,1H3,(H2,8,9)(H,10,11);1H.
What are the key properties of 2-(2-amino-4-methoxycarbonyl-1,3-thiazol-5-yl)acetic acid;hydrobromide?
2-(2-amino-4-methoxycarbonyl-1,3-thiazol-5-yl)acetic acid;hydrobromide has a molecular weight of 297.13 g/mol, XLogP of 0.72, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-4-methoxycarbonyl-1,3-thiazol-5-yl)acetic acid;hydrobromide is sourced from PubChem (CID 20788300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).