C10H5Br2Cl3N2O — CID 20788346
4,4-dibromo-5-methyl-2-(2,4,6-trichlorophenyl)pyrazol-3-one (PubChem CID 20788346) has the molecular formula C10H5Br2Cl3N2O and a molecular weight of 435.33 g/mol. Its IUPAC name is 4,4-dibromo-5-methyl-2-(2,4,6-trichlorophenyl)pyrazol-3-one.
| Compound Name | 4,4-dibromo-5-methyl-2-(2,4,6-trichlorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 20788346 |
| Molecular Formula | C10H5Br2Cl3N2O |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 431.78 |
| IUPAC Name | 4,4-dibromo-5-methyl-2-(2,4,6-trichlorophenyl)pyrazol-3-one |
| SMILES | CC1=NN(c2c(Cl)cc(Cl)cc2Cl)C(=O)C1(Br)Br |
| InChI | InChI=1S/C10H5Br2Cl3N2O/c1-4-10(11,12)9(18)17(16-4)8-6(14)2-5(13)3-7(8)15/h2-3H,1H3 |
| InChIKey | CZELYJIOWCRWIW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|