About 6,7-dichloro-2-methyl-1H-pyrazolo[1,5-a]benzimidazole
6,7-dichloro-2-methyl-1H-pyrazolo[1,5-a]benzimidazole (PubChem CID 20788432) has the molecular formula C10H7Cl2N3
and a molecular weight of 240.09 g/mol. Its IUPAC name is 6,7-dichloro-2-methyl-1H-pyrazolo[1,5-a]benzimidazole.
Molecular Properties
| Compound Name | 6,7-dichloro-2-methyl-1H-pyrazolo[1,5-a]benzimidazole |
| PubChem CID | 20788432 |
| Molecular Formula | C10H7Cl2N3 |
| Molecular Weight | 240.09 g/mol |
| Exact Mass | 239.00 |
| IUPAC Name | 6,7-dichloro-2-methyl-1H-pyrazolo[1,5-a]benzimidazole |
| SMILES | Cc1cc2nc3cc(Cl)c(Cl)cc3n2[nH]1 |
| InChI | InChI=1S/C10H7Cl2N3/c1-5-2-10-13-8-3-6(11)7(12)4-9(8)15(10)14-5/h2-4,14H,1H3 |
| InChIKey | FGPOJWMJSPZEJX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.09 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-dichloro-2-methyl-1H-pyrazolo[1,5-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dichloro-2-methyl-1H-pyrazolo[1,5-a]benzimidazole?
The IUPAC name of 6,7-dichloro-2-methyl-1H-pyrazolo[1,5-a]benzimidazole (CID 20788432) is 6,7-dichloro-2-methyl-1H-pyrazolo[1,5-a]benzimidazole.
What is the SMILES notation for 6,7-dichloro-2-methyl-1H-pyrazolo[1,5-a]benzimidazole?
The canonical SMILES for 6,7-dichloro-2-methyl-1H-pyrazolo[1,5-a]benzimidazole is Cc1cc2nc3cc(Cl)c(Cl)cc3n2[nH]1.
What is the InChIKey of 6,7-dichloro-2-methyl-1H-pyrazolo[1,5-a]benzimidazole?
The InChIKey is FGPOJWMJSPZEJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl2N3/c1-5-2-10-13-8-3-6(11)7(12)4-9(8)15(10)14-5/h2-4,14H,1H3.
What are the key properties of 6,7-dichloro-2-methyl-1H-pyrazolo[1,5-a]benzimidazole?
6,7-dichloro-2-methyl-1H-pyrazolo[1,5-a]benzimidazole has a molecular weight of 240.09 g/mol, XLogP of 3.43, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dichloro-2-methyl-1H-pyrazolo[1,5-a]benzimidazole is sourced from PubChem (CID 20788432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).