C18H17N5O2 — CID 20789035
3-[3-(2-methoxyethoxy)phenyl]-5-(1H-1,2,4-triazol-5-yl)-1H-indazole (PubChem CID 20789035) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is 3-[3-(2-methoxyethoxy)phenyl]-5-(1H-1,2,4-triazol-5-yl)-1H-indazole.
| Compound Name | 3-[3-(2-methoxyethoxy)phenyl]-5-(1H-1,2,4-triazol-5-yl)-1H-indazole |
|---|---|
| PubChem CID | 20789035 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 3-[3-(2-methoxyethoxy)phenyl]-5-(1H-1,2,4-triazol-5-yl)-1H-indazole |
| SMILES | COCCOc1cccc(-c2n[nH]c3ccc(-c4ncn[nH]4)cc23)c1 |
| InChI | InChI=1S/C18H17N5O2/c1-24-7-8-25-14-4-2-3-12(9-14)17-15-10-13(18-19-11-20-23-18)5-6-16(15)21-22-17/h2-6,9-11H,7-8H2,1H3,(H,21,22)(H,19,20,23) |
| InChIKey | RLDATFUCNNRFAJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|