C25H33N2Ni- — CID 20789268
carbanide;3-methyl-1-N,2-N-bis(2,4,6-trimethylphenyl)cyclopentane-1,2-diimine;nickel (PubChem CID 20789268) has the molecular formula C25H33N2Ni- and a molecular weight of 420.25 g/mol. Its IUPAC name is carbanide;3-methyl-1-N,2-N-bis(2,4,6-trimethylphenyl)cyclopentane-1,2-diimine;nickel.
| Compound Name | carbanide;3-methyl-1-N,2-N-bis(2,4,6-trimethylphenyl)cyclopentane-1,2-diimine;nickel |
|---|---|
| PubChem CID | 20789268 |
| Molecular Formula | C25H33N2Ni- |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | carbanide;3-methyl-1-N,2-N-bis(2,4,6-trimethylphenyl)cyclopentane-1,2-diimine;nickel |
| SMILES | Cc1cc(C)c(/N=C2\CCC(C)\C2=N/c2c(C)cc(C)cc2C)c(C)c1.[CH3-].[Ni] |
| InChI | InChI=1S/C24H30N2.CH3.Ni/c1-14-10-17(4)22(18(5)11-14)25-21-9-8-16(3)24(21)26-23-19(6)12-15(2)13-20(23)7;;/h10-13,16H,8-9H2,1-7H3;1H3;/q;-1;/b25-21+,26-24+;; |
| InChIKey | XJONQNZTICQWAB-WRBUNQOLSA-N |
| XLogP | 7.26 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|