C14H18N4 — CID 20789347
(E)-N,N'-bis(2,5-dimethylpyrrol-1-yl)ethane-1,2-diimine (PubChem CID 20789347) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is (E)-N,N'-bis(2,5-dimethylpyrrol-1-yl)ethane-1,2-diimine.
| Compound Name | (E)-N,N'-bis(2,5-dimethylpyrrol-1-yl)ethane-1,2-diimine |
|---|---|
| PubChem CID | 20789347 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (E)-N,N'-bis(2,5-dimethylpyrrol-1-yl)ethane-1,2-diimine |
| SMILES | Cc1ccc(C)n1/N=C/C=N/n1c(C)ccc1C |
| InChI | InChI=1S/C14H18N4/c1-11-5-6-12(2)17(11)15-9-10-16-18-13(3)7-8-14(18)4/h5-10H,1-4H3/b15-9+,16-10+ |
| InChIKey | PPXIGOLBZPYMNF-KAVGSWPWSA-N |
| XLogP | 2.89 |
| TPSA | 34.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|