C14H14O4 — CID 20789714
spiro[11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9,3'-oxolane]-2',5'-dione (PubChem CID 20789714) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is spiro[11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9,3'-oxolane]-2',5'-dione.
| Compound Name | spiro[11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9,3'-oxolane]-2',5'-dione |
|---|---|
| PubChem CID | 20789714 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | spiro[11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9,3'-oxolane]-2',5'-dione |
| SMILES | O=C1CC2(CC3OC2C2C4C=CC(C4)C32)C(=O)O1 |
| InChI | InChI=1S/C14H14O4/c15-9-5-14(13(16)18-9)4-8-10-6-1-2-7(3-6)11(10)12(14)17-8/h1-2,6-8,10-12H,3-5H2 |
| InChIKey | GLRZCWZHEMNPCK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|