C29H30ClNO4 — CID 20790046
4-[4-(4-chlorophenyl)phenyl]-2-[2-[3-(diethylcarbamoyl)phenyl]ethyl]-4-oxobutanoic acid (PubChem CID 20790046) has the molecular formula C29H30ClNO4 and a molecular weight of 492.02 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)phenyl]-2-[2-[3-(diethylcarbamoyl)phenyl]ethyl]-4-oxobutanoic acid.
| Compound Name | 4-[4-(4-chlorophenyl)phenyl]-2-[2-[3-(diethylcarbamoyl)phenyl]ethyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 20790046 |
| Molecular Formula | C29H30ClNO4 |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 4-[4-(4-chlorophenyl)phenyl]-2-[2-[3-(diethylcarbamoyl)phenyl]ethyl]-4-oxobutanoic acid |
| SMILES | CCN(CC)C(=O)c1cccc(CCC(CC(=O)c2ccc(-c3ccc(Cl)cc3)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C29H30ClNO4/c1-3-31(4-2)28(33)24-7-5-6-20(18-24)8-9-25(29(34)35)19-27(32)23-12-10-21(11-13-23)22-14-16-26(30)17-15-22/h5-7,10-18,25H,3-4,8-9,19H2,1-2H3,(H,34,35) |
| InChIKey | XSBODJHJPRCZJV-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |