C24H20F3N3O3 — CID 20790642
2-anilino-7-(2-methoxyethoxy)-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one (PubChem CID 20790642) has the molecular formula C24H20F3N3O3 and a molecular weight of 455.44 g/mol. Its IUPAC name is 2-anilino-7-(2-methoxyethoxy)-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one.
| Compound Name | 2-anilino-7-(2-methoxyethoxy)-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 20790642 |
| Molecular Formula | C24H20F3N3O3 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 2-anilino-7-(2-methoxyethoxy)-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one |
| SMILES | COCCOc1cc(C(F)(F)F)c2c(=O)cc(Nc3ccccc3)n(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C24H20F3N3O3/c1-32-12-13-33-21-14-18(24(25,26)27)22-19(31)15-20(28-16-8-4-2-5-9-16)30(23(22)29-21)17-10-6-3-7-11-17/h2-11,14-15,28H,12-13H2,1H3 |
| InChIKey | JDQDAQSBEWGODM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|