About 5-chloro-2-(3-fluoroanilino)-1-(3-fluorophenyl)-7-methyl-1,8-naphthyridin-4-one
5-chloro-2-(3-fluoroanilino)-1-(3-fluorophenyl)-7-methyl-1,8-naphthyridin-4-one (PubChem CID 20791031) has the molecular formula C21H14ClF2N3O
and a molecular weight of 397.81 g/mol. Its IUPAC name is 5-chloro-2-(3-fluoroanilino)-1-(3-fluorophenyl)-7-methyl-1,8-naphthyridin-4-one.
Molecular Properties
| Compound Name | 5-chloro-2-(3-fluoroanilino)-1-(3-fluorophenyl)-7-methyl-1,8-naphthyridin-4-one |
| PubChem CID | 20791031 |
| Molecular Formula | C21H14ClF2N3O |
| Molecular Weight | 397.81 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 5-chloro-2-(3-fluoroanilino)-1-(3-fluorophenyl)-7-methyl-1,8-naphthyridin-4-one |
| SMILES | Cc1cc(Cl)c2c(=O)cc(Nc3cccc(F)c3)n(-c3cccc(F)c3)c2n1 |
| InChI | InChI=1S/C21H14ClF2N3O/c1-12-8-17(22)20-18(28)11-19(26-15-6-2-4-13(23)9-15)27(21(20)25-12)16-7-3-5-14(24)10-16/h2-11,26H,1H3 |
| InChIKey | LVXWELDZOOLOPW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.81 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-2-(3-fluoroanilino)-1-(3-fluorophenyl)-7-methyl-1,8-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(3-fluoroanilino)-1-(3-fluorophenyl)-7-methyl-1,8-naphthyridin-4-one?
The IUPAC name of 5-chloro-2-(3-fluoroanilino)-1-(3-fluorophenyl)-7-methyl-1,8-naphthyridin-4-one (CID 20791031) is 5-chloro-2-(3-fluoroanilino)-1-(3-fluorophenyl)-7-methyl-1,8-naphthyridin-4-one.
What is the SMILES notation for 5-chloro-2-(3-fluoroanilino)-1-(3-fluorophenyl)-7-methyl-1,8-naphthyridin-4-one?
The canonical SMILES for 5-chloro-2-(3-fluoroanilino)-1-(3-fluorophenyl)-7-methyl-1,8-naphthyridin-4-one is Cc1cc(Cl)c2c(=O)cc(Nc3cccc(F)c3)n(-c3cccc(F)c3)c2n1.
What is the InChIKey of 5-chloro-2-(3-fluoroanilino)-1-(3-fluorophenyl)-7-methyl-1,8-naphthyridin-4-one?
The InChIKey is LVXWELDZOOLOPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14ClF2N3O/c1-12-8-17(22)20-18(28)11-19(26-15-6-2-4-13(23)9-15)27(21(20)25-12)16-7-3-5-14(24)10-16/h2-11,26H,1H3.
What are the key properties of 5-chloro-2-(3-fluoroanilino)-1-(3-fluorophenyl)-7-methyl-1,8-naphthyridin-4-one?
5-chloro-2-(3-fluoroanilino)-1-(3-fluorophenyl)-7-methyl-1,8-naphthyridin-4-one has a molecular weight of 397.81 g/mol, XLogP of 5.37, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(3-fluoroanilino)-1-(3-fluorophenyl)-7-methyl-1,8-naphthyridin-4-one is sourced from PubChem (CID 20791031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).