C27H26N4O5 — CID 20791598
ethyl 3-cyano-5-(2-methoxyethoxymethyl)-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazine-6-carboxylate (PubChem CID 20791598) has the molecular formula C27H26N4O5 and a molecular weight of 486.53 g/mol. Its IUPAC name is ethyl 3-cyano-5-(2-methoxyethoxymethyl)-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazine-6-carboxylate.
| Compound Name | ethyl 3-cyano-5-(2-methoxyethoxymethyl)-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazine-6-carboxylate |
|---|---|
| PubChem CID | 20791598 |
| Molecular Formula | C27H26N4O5 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | ethyl 3-cyano-5-(2-methoxyethoxymethyl)-4-(4-phenoxyanilino)pyrrolo[1,2-b]pyridazine-6-carboxylate |
| SMILES | CCOC(=O)c1cn2ncc(C#N)c(Nc3ccc(Oc4ccccc4)cc3)c2c1COCCOC |
| InChI | InChI=1S/C27H26N4O5/c1-3-35-27(32)23-17-31-26(24(23)18-34-14-13-33-2)25(19(15-28)16-29-31)30-20-9-11-22(12-10-20)36-21-7-5-4-6-8-21/h4-12,16-17,30H,3,13-14,18H2,1-2H3 |
| InChIKey | KFMRYMVQQFVLPX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|