C27H36N2O6 — CID 20791849
4-methyl-1-(3-propan-2-yloxypropyl)-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazine-2,5-dione (PubChem CID 20791849) has the molecular formula C27H36N2O6 and a molecular weight of 484.59 g/mol. Its IUPAC name is 4-methyl-1-(3-propan-2-yloxypropyl)-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazine-2,5-dione.
| Compound Name | 4-methyl-1-(3-propan-2-yloxypropyl)-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 20791849 |
| Molecular Formula | C27H36N2O6 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 4-methyl-1-(3-propan-2-yloxypropyl)-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazine-2,5-dione |
| SMILES | COc1cc(-c2ccc(CC3C(=O)N(CCCOC(C)C)CC(=O)N3C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C27H36N2O6/c1-18(2)35-13-7-12-29-17-25(30)28(3)22(27(29)31)14-19-8-10-20(11-9-19)21-15-23(32-4)26(34-6)24(16-21)33-5/h8-11,15-16,18,22H,7,12-14,17H2,1-6H3 |
| InChIKey | GTSQTINCTSHWEC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|