C34H49N3O6 — CID 20791887
2-[4-butyl-2,5-dioxo-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazin-1-yl]-N-octylacetamide (PubChem CID 20791887) has the molecular formula C34H49N3O6 and a molecular weight of 595.78 g/mol. Its IUPAC name is 2-[4-butyl-2,5-dioxo-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazin-1-yl]-N-octylacetamide.
| Compound Name | 2-[4-butyl-2,5-dioxo-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazin-1-yl]-N-octylacetamide |
|---|---|
| PubChem CID | 20791887 |
| Molecular Formula | C34H49N3O6 |
| Molecular Weight | 595.78 g/mol |
| Exact Mass | 595.36 |
| IUPAC Name | 2-[4-butyl-2,5-dioxo-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazin-1-yl]-N-octylacetamide |
| SMILES | CCCCCCCCNC(=O)CN1CC(=O)N(CCCC)C(Cc2ccc(-c3cc(OC)c(OC)c(OC)c3)cc2)C1=O |
| InChI | InChI=1S/C34H49N3O6/c1-6-8-10-11-12-13-18-35-31(38)23-36-24-32(39)37(19-9-7-2)28(34(36)40)20-25-14-16-26(17-15-25)27-21-29(41-3)33(43-5)30(22-27)42-4/h14-17,21-22,28H,6-13,18-20,23-24H2,1-5H3,(H,35,38) |
| InChIKey | UOVSBCWUBYMFCH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.78 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|