About tert-butyl N-(5,5-dimethylpiperidin-3-yl)carbamate
tert-butyl N-(5,5-dimethylpiperidin-3-yl)carbamate (PubChem CID 20792133) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is tert-butyl N-(5,5-dimethylpiperidin-3-yl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(5,5-dimethylpiperidin-3-yl)carbamate |
| PubChem CID | 20792133 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | tert-butyl N-(5,5-dimethylpiperidin-3-yl)carbamate |
| SMILES | CC1(C)CNCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C12H24N2O2/c1-11(2,3)16-10(15)14-9-6-12(4,5)8-13-7-9/h9,13H,6-8H2,1-5H3,(H,14,15) |
| InChIKey | QUTRKKUYVZIMQK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-(5,5-dimethylpiperidin-3-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(5,5-dimethylpiperidin-3-yl)carbamate?
The IUPAC name of tert-butyl N-(5,5-dimethylpiperidin-3-yl)carbamate (CID 20792133) is tert-butyl N-(5,5-dimethylpiperidin-3-yl)carbamate.
What is the SMILES notation for tert-butyl N-(5,5-dimethylpiperidin-3-yl)carbamate?
The canonical SMILES for tert-butyl N-(5,5-dimethylpiperidin-3-yl)carbamate is CC1(C)CNCC(NC(=O)OC(C)(C)C)C1.
What is the InChIKey of tert-butyl N-(5,5-dimethylpiperidin-3-yl)carbamate?
The InChIKey is QUTRKKUYVZIMQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-11(2,3)16-10(15)14-9-6-12(4,5)8-13-7-9/h9,13H,6-8H2,1-5H3,(H,14,15).
What are the key properties of tert-butyl N-(5,5-dimethylpiperidin-3-yl)carbamate?
tert-butyl N-(5,5-dimethylpiperidin-3-yl)carbamate has a molecular weight of 228.34 g/mol, XLogP of 1.90, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(5,5-dimethylpiperidin-3-yl)carbamate is sourced from PubChem (CID 20792133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).