C19H18F6N2O2 — CID 20792432
N-benzyl-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]propanamide (PubChem CID 20792432) has the molecular formula C19H18F6N2O2 and a molecular weight of 420.35 g/mol. Its IUPAC name is N-benzyl-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]propanamide.
| Compound Name | N-benzyl-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]propanamide |
|---|---|
| PubChem CID | 20792432 |
| Molecular Formula | C19H18F6N2O2 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | N-benzyl-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]propanamide |
| SMILES | CC(Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H18F6N2O2/c1-12(16(28)26-11-13-5-3-2-4-6-13)27-15-9-7-14(8-10-15)17(29,18(20,21)22)19(23,24)25/h2-10,12,27,29H,11H2,1H3,(H,26,28) |
| InChIKey | VCGZLMCPMJBLJP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |