C11H23NO2 — CID 20792507
1-hydroxy-2,2,3,5,6,6-hexamethylpiperidin-4-ol (PubChem CID 20792507) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is 1-hydroxy-2,2,3,5,6,6-hexamethylpiperidin-4-ol.
| Compound Name | 1-hydroxy-2,2,3,5,6,6-hexamethylpiperidin-4-ol |
|---|---|
| PubChem CID | 20792507 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 1-hydroxy-2,2,3,5,6,6-hexamethylpiperidin-4-ol |
| SMILES | CC1C(O)C(C)C(C)(C)N(O)C1(C)C |
| InChI | InChI=1S/C11H23NO2/c1-7-9(13)8(2)11(5,6)12(14)10(7,3)4/h7-9,13-14H,1-6H3 |
| InChIKey | XREWBHFYVUHZTO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |