C29H56N4O4 — CID 20792527
[4-[6-[(1-acetyloxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]hexylamino]-2,2,6,6-tetramethylpiperidin-1-yl] propanoate (PubChem CID 20792527) has the molecular formula C29H56N4O4 and a molecular weight of 524.79 g/mol. Its IUPAC name is [4-[6-[(1-acetyloxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]hexylamino]-2,2,6,6-tetramethylpiperidin-1-yl] propanoate.
| Compound Name | [4-[6-[(1-acetyloxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]hexylamino]-2,2,6,6-tetramethylpiperidin-1-yl] propanoate |
|---|---|
| PubChem CID | 20792527 |
| Molecular Formula | C29H56N4O4 |
| Molecular Weight | 524.79 g/mol |
| Exact Mass | 524.43 |
| IUPAC Name | [4-[6-[(1-acetyloxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]hexylamino]-2,2,6,6-tetramethylpiperidin-1-yl] propanoate |
| SMILES | CCC(=O)ON1C(C)(C)CC(NCCCCCCNC2CC(C)(C)N(OC(C)=O)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C29H56N4O4/c1-11-25(35)37-33-28(7,8)20-24(21-29(33,9)10)31-17-15-13-12-14-16-30-23-18-26(3,4)32(36-22(2)34)27(5,6)19-23/h23-24,30-31H,11-21H2,1-10H3 |
| InChIKey | QUJVEXJYPFYEFE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.79 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|