C15H20FN5O6S2 — CID 20792617
6-fluoro-2-N-[2-(2-methoxyperoxysulfanyloxyethylsulfonyl)ethyl]-4-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 20792617) has the molecular formula C15H20FN5O6S2 and a molecular weight of 449.49 g/mol. Its IUPAC name is 6-fluoro-2-N-[2-(2-methoxyperoxysulfanyloxyethylsulfonyl)ethyl]-4-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-fluoro-2-N-[2-(2-methoxyperoxysulfanyloxyethylsulfonyl)ethyl]-4-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 20792617 |
| Molecular Formula | C15H20FN5O6S2 |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 6-fluoro-2-N-[2-(2-methoxyperoxysulfanyloxyethylsulfonyl)ethyl]-4-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(F)nc(N(CCS(=O)(=O)CCOSOOOC)c2ccccc2)n1 |
| InChI | InChI=1S/C15H20FN5O6S2/c1-17-14-18-13(16)19-15(20-14)21(12-6-4-3-5-7-12)8-10-29(22,23)11-9-25-28-27-26-24-2/h3-7H,8-11H2,1-2H3,(H,17,18,19,20) |
| InChIKey | VGCOCESLNGAEEW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|