About 3-methyl-2H-imidazo[1,2-a]pyridin-2-ide;yttrium(3+)
3-methyl-2H-imidazo[1,2-a]pyridin-2-ide;yttrium(3+) (PubChem CID 20792738) has the molecular formula C8H7N2Y+2
and a molecular weight of 220.06 g/mol. Its IUPAC name is 3-methyl-2H-imidazo[1,2-a]pyridin-2-ide;yttrium(3+).
Molecular Properties
| Compound Name | 3-methyl-2H-imidazo[1,2-a]pyridin-2-ide;yttrium(3+) |
| PubChem CID | 20792738 |
| Molecular Formula | C8H7N2Y+2 |
| Molecular Weight | 220.06 g/mol |
| Exact Mass | 219.97 |
| IUPAC Name | 3-methyl-2H-imidazo[1,2-a]pyridin-2-ide;yttrium(3+) |
| SMILES | Cc1[c-]nc2ccccn12.[Y+3] |
| InChI | InChI=1S/C8H7N2.Y/c1-7-6-9-8-4-2-3-5-10(7)8;/h2-5H,1H3;/q-1;+3 |
| InChIKey | VYCOXVPZKCFROP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.06 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2H-imidazo[1,2-a]pyridin-2-ide;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2H-imidazo[1,2-a]pyridin-2-ide;yttrium(3+)?
The IUPAC name of 3-methyl-2H-imidazo[1,2-a]pyridin-2-ide;yttrium(3+) (CID 20792738) is 3-methyl-2H-imidazo[1,2-a]pyridin-2-ide;yttrium(3+).
What is the SMILES notation for 3-methyl-2H-imidazo[1,2-a]pyridin-2-ide;yttrium(3+)?
The canonical SMILES for 3-methyl-2H-imidazo[1,2-a]pyridin-2-ide;yttrium(3+) is Cc1[c-]nc2ccccn12.[Y+3].
What is the InChIKey of 3-methyl-2H-imidazo[1,2-a]pyridin-2-ide;yttrium(3+)?
The InChIKey is VYCOXVPZKCFROP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N2.Y/c1-7-6-9-8-4-2-3-5-10(7)8;/h2-5H,1H3;/q-1;+3.
What are the key properties of 3-methyl-2H-imidazo[1,2-a]pyridin-2-ide;yttrium(3+)?
3-methyl-2H-imidazo[1,2-a]pyridin-2-ide;yttrium(3+) has a molecular weight of 220.06 g/mol, XLogP of 1.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2H-imidazo[1,2-a]pyridin-2-ide;yttrium(3+) is sourced from PubChem (CID 20792738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).