C18H35NO2 — CID 20792754
1-cyclohexyloxy-2,2,6,6-tetramethyl-4-propoxypiperidine (PubChem CID 20792754) has the molecular formula C18H35NO2 and a molecular weight of 297.48 g/mol. Its IUPAC name is 1-cyclohexyloxy-2,2,6,6-tetramethyl-4-propoxypiperidine.
| Compound Name | 1-cyclohexyloxy-2,2,6,6-tetramethyl-4-propoxypiperidine |
|---|---|
| PubChem CID | 20792754 |
| Molecular Formula | C18H35NO2 |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.27 |
| IUPAC Name | 1-cyclohexyloxy-2,2,6,6-tetramethyl-4-propoxypiperidine |
| SMILES | CCCOC1CC(C)(C)N(OC2CCCCC2)C(C)(C)C1 |
| InChI | InChI=1S/C18H35NO2/c1-6-12-20-16-13-17(2,3)19(18(4,5)14-16)21-15-10-8-7-9-11-15/h15-16H,6-14H2,1-5H3 |
| InChIKey | XIMOZSUMIJUIOD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |