About N-(3,3-dimethylbutyl)-N'-(2-hydroxyethyl)oxamide
N-(3,3-dimethylbutyl)-N'-(2-hydroxyethyl)oxamide (PubChem CID 20793029) has the molecular formula C10H20N2O3
and a molecular weight of 216.28 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-N'-(2-hydroxyethyl)oxamide.
Molecular Properties
| Compound Name | N-(3,3-dimethylbutyl)-N'-(2-hydroxyethyl)oxamide |
| PubChem CID | 20793029 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | N-(3,3-dimethylbutyl)-N'-(2-hydroxyethyl)oxamide |
| SMILES | CC(C)(C)CCNC(=O)C(=O)NCCO |
| InChI | InChI=1S/C10H20N2O3/c1-10(2,3)4-5-11-8(14)9(15)12-6-7-13/h13H,4-7H2,1-3H3,(H,11,14)(H,12,15) |
| InChIKey | LUVJQJMHOVHWHW-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3,3-dimethylbutyl)-N'-(2-hydroxyethyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-dimethylbutyl)-N'-(2-hydroxyethyl)oxamide?
The IUPAC name of N-(3,3-dimethylbutyl)-N'-(2-hydroxyethyl)oxamide (CID 20793029) is N-(3,3-dimethylbutyl)-N'-(2-hydroxyethyl)oxamide.
What is the SMILES notation for N-(3,3-dimethylbutyl)-N'-(2-hydroxyethyl)oxamide?
The canonical SMILES for N-(3,3-dimethylbutyl)-N'-(2-hydroxyethyl)oxamide is CC(C)(C)CCNC(=O)C(=O)NCCO.
What is the InChIKey of N-(3,3-dimethylbutyl)-N'-(2-hydroxyethyl)oxamide?
The InChIKey is LUVJQJMHOVHWHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O3/c1-10(2,3)4-5-11-8(14)9(15)12-6-7-13/h13H,4-7H2,1-3H3,(H,11,14)(H,12,15).
What are the key properties of N-(3,3-dimethylbutyl)-N'-(2-hydroxyethyl)oxamide?
N-(3,3-dimethylbutyl)-N'-(2-hydroxyethyl)oxamide has a molecular weight of 216.28 g/mol, XLogP of -0.35, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-dimethylbutyl)-N'-(2-hydroxyethyl)oxamide is sourced from PubChem (CID 20793029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).