C7H2F10O — CID 20793131
2,2,3,3,6,7,7-heptafluoro-4-(trifluoromethyl)-4H-oxepine (PubChem CID 20793131) has the molecular formula C7H2F10O and a molecular weight of 292.07 g/mol. Its IUPAC name is 2,2,3,3,6,7,7-heptafluoro-4-(trifluoromethyl)-4H-oxepine.
| Compound Name | 2,2,3,3,6,7,7-heptafluoro-4-(trifluoromethyl)-4H-oxepine |
|---|---|
| PubChem CID | 20793131 |
| Molecular Formula | C7H2F10O |
| Molecular Weight | 292.07 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | 2,2,3,3,6,7,7-heptafluoro-4-(trifluoromethyl)-4H-oxepine |
| SMILES | FC1=CC(C(F)(F)F)C(F)(F)C(F)(F)OC1(F)F |
| InChI | InChI=1S/C7H2F10O/c8-3-1-2(5(11,12)13)4(9,10)7(16,17)18-6(3,14)15/h1-2H |
| InChIKey | BOUGALIQDXWLME-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.07 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|