C6H4F8O2 — CID 20793141
2,3,3-trifluoro-3-[1,1,2,2-tetrafluoro-2-(fluoromethoxy)ethoxy]prop-1-ene (PubChem CID 20793141) has the molecular formula C6H4F8O2 and a molecular weight of 260.08 g/mol. Its IUPAC name is 2,3,3-trifluoro-3-[1,1,2,2-tetrafluoro-2-(fluoromethoxy)ethoxy]prop-1-ene.
| Compound Name | 2,3,3-trifluoro-3-[1,1,2,2-tetrafluoro-2-(fluoromethoxy)ethoxy]prop-1-ene |
|---|---|
| PubChem CID | 20793141 |
| Molecular Formula | C6H4F8O2 |
| Molecular Weight | 260.08 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 2,3,3-trifluoro-3-[1,1,2,2-tetrafluoro-2-(fluoromethoxy)ethoxy]prop-1-ene |
| SMILES | C=C(F)C(F)(F)OC(F)(F)C(F)(F)OCF |
| InChI | InChI=1S/C6H4F8O2/c1-3(8)4(9,10)16-6(13,14)5(11,12)15-2-7/h1-2H2 |
| InChIKey | IREYRBCKTPXREH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.08 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|