C7H8F6O2 — CID 20793159
4,5-dimethyl-2,2-bis(trifluoromethyl)-1,3-dioxolane (PubChem CID 20793159) has the molecular formula C7H8F6O2 and a molecular weight of 238.13 g/mol. Its IUPAC name is 4,5-dimethyl-2,2-bis(trifluoromethyl)-1,3-dioxolane.
| Compound Name | 4,5-dimethyl-2,2-bis(trifluoromethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 20793159 |
| Molecular Formula | C7H8F6O2 |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 4,5-dimethyl-2,2-bis(trifluoromethyl)-1,3-dioxolane |
| SMILES | CC1OC(C(F)(F)F)(C(F)(F)F)OC1C |
| InChI | InChI=1S/C7H8F6O2/c1-3-4(2)15-5(14-3,6(8,9)10)7(11,12)13/h3-4H,1-2H3 |
| InChIKey | NMCQHMALQZKDRR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |