C20H36N2O3S — CID 20793760
6-[3-(2-tert-butyl-3,3-dimethylbutyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanamide (PubChem CID 20793760) has the molecular formula C20H36N2O3S and a molecular weight of 384.59 g/mol. Its IUPAC name is 6-[3-(2-tert-butyl-3,3-dimethylbutyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanamide.
| Compound Name | 6-[3-(2-tert-butyl-3,3-dimethylbutyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanamide |
|---|---|
| PubChem CID | 20793760 |
| Molecular Formula | C20H36N2O3S |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 6-[3-(2-tert-butyl-3,3-dimethylbutyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanamide |
| SMILES | CC(C)(C)C(CSC1CC(=O)N(CCCCCC(N)=O)C1=O)C(C)(C)C |
| InChI | InChI=1S/C20H36N2O3S/c1-19(2,3)15(20(4,5)6)13-26-14-12-17(24)22(18(14)25)11-9-7-8-10-16(21)23/h14-15H,7-13H2,1-6H3,(H2,21,23) |
| InChIKey | QGNGUHJBFXAMNC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|