About 2-(tert-butylamino)hexane-1,5-dione;rhodium(2+)
2-(tert-butylamino)hexane-1,5-dione;rhodium(2+) (PubChem CID 20793795) has the molecular formula C10H18NO2Rh+
and a molecular weight of 287.17 g/mol. Its IUPAC name is 2-(tert-butylamino)hexane-1,5-dione;rhodium(2+).
Molecular Properties
| Compound Name | 2-(tert-butylamino)hexane-1,5-dione;rhodium(2+) |
| PubChem CID | 20793795 |
| Molecular Formula | C10H18NO2Rh+ |
| Molecular Weight | 287.17 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 2-(tert-butylamino)hexane-1,5-dione;rhodium(2+) |
| SMILES | CC(=O)CCC([C-]=O)NC(C)(C)C.[Rh+2] |
| InChI | InChI=1S/C10H18NO2.Rh/c1-8(13)5-6-9(7-12)11-10(2,3)4;/h9,11H,5-6H2,1-4H3;/q-1;+2 |
| InChIKey | GIQDFOLANLWOQX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.17 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(tert-butylamino)hexane-1,5-dione;rhodium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tert-butylamino)hexane-1,5-dione;rhodium(2+)?
The IUPAC name of 2-(tert-butylamino)hexane-1,5-dione;rhodium(2+) (CID 20793795) is 2-(tert-butylamino)hexane-1,5-dione;rhodium(2+).
What is the SMILES notation for 2-(tert-butylamino)hexane-1,5-dione;rhodium(2+)?
The canonical SMILES for 2-(tert-butylamino)hexane-1,5-dione;rhodium(2+) is CC(=O)CCC([C-]=O)NC(C)(C)C.[Rh+2].
What is the InChIKey of 2-(tert-butylamino)hexane-1,5-dione;rhodium(2+)?
The InChIKey is GIQDFOLANLWOQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18NO2.Rh/c1-8(13)5-6-9(7-12)11-10(2,3)4;/h9,11H,5-6H2,1-4H3;/q-1;+2.
What are the key properties of 2-(tert-butylamino)hexane-1,5-dione;rhodium(2+)?
2-(tert-butylamino)hexane-1,5-dione;rhodium(2+) has a molecular weight of 287.17 g/mol, XLogP of 1.22, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tert-butylamino)hexane-1,5-dione;rhodium(2+) is sourced from PubChem (CID 20793795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).