C23H26Cl2N2O7S — CID 20793908
(2S)-2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-[4-(2-methoxyethoxy)phenyl]propanoic acid (PubChem CID 20793908) has the molecular formula C23H26Cl2N2O7S and a molecular weight of 545.44 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-[4-(2-methoxyethoxy)phenyl]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-[4-(2-methoxyethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 20793908 |
| Molecular Formula | C23H26Cl2N2O7S |
| Molecular Weight | 545.44 g/mol |
| Exact Mass | 544.08 |
| IUPAC Name | (2S)-2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-[4-(2-methoxyethoxy)phenyl]propanoic acid |
| SMILES | COCCOc1ccc(C[C@H](NC(=O)[C@@H]2CCCN2S(=O)(=O)c2cc(Cl)cc(Cl)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C23H26Cl2N2O7S/c1-33-9-10-34-18-6-4-15(5-7-18)11-20(23(29)30)26-22(28)21-3-2-8-27(21)35(31,32)19-13-16(24)12-17(25)14-19/h4-7,12-14,20-21H,2-3,8-11H2,1H3,(H,26,28)(H,29,30)/t20-,21-/m0/s1 |
| InChIKey | DLLGQRYZARKEBS-SFTDATJTSA-N |
| XLogP | 2.98 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|