C24H28Cl2N2O6S — CID 20793916
(2S)-3-(4-butoxyphenyl)-2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]propanoic acid (PubChem CID 20793916) has the molecular formula C24H28Cl2N2O6S and a molecular weight of 543.47 g/mol. Its IUPAC name is (2S)-3-(4-butoxyphenyl)-2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]propanoic acid.
| Compound Name | (2S)-3-(4-butoxyphenyl)-2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 20793916 |
| Molecular Formula | C24H28Cl2N2O6S |
| Molecular Weight | 543.47 g/mol |
| Exact Mass | 542.10 |
| IUPAC Name | (2S)-3-(4-butoxyphenyl)-2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]propanoic acid |
| SMILES | CCCCOc1ccc(C[C@H](NC(=O)[C@@H]2CCCN2S(=O)(=O)c2cc(Cl)cc(Cl)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C24H28Cl2N2O6S/c1-2-3-11-34-19-8-6-16(7-9-19)12-21(24(30)31)27-23(29)22-5-4-10-28(22)35(32,33)20-14-17(25)13-18(26)15-20/h6-9,13-15,21-22H,2-5,10-12H2,1H3,(H,27,29)(H,30,31)/t21-,22-/m0/s1 |
| InChIKey | JNMQDVKBQWASOW-VXKWHMMOSA-N |
| XLogP | 4.14 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|