C15H17NO3S — CID 2079410
(3R,7aR)-7a-(2,4-dimethylphenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylic acid (PubChem CID 2079410) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is (3R,7aR)-7a-(2,4-dimethylphenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylic acid.
| Compound Name | (3R,7aR)-7a-(2,4-dimethylphenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 2079410 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | (3R,7aR)-7a-(2,4-dimethylphenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylic acid |
| SMILES | Cc1ccc([C@]23CCC(=O)N2[C@H](C(=O)O)CS3)c(C)c1 |
| InChI | InChI=1S/C15H17NO3S/c1-9-3-4-11(10(2)7-9)15-6-5-13(17)16(15)12(8-20-15)14(18)19/h3-4,7,12H,5-6,8H2,1-2H3,(H,18,19)/t12-,15+/m0/s1 |
| InChIKey | NAUDDVLABQQISK-SWLSCSKDSA-N |
| XLogP | 2.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |