C12H22N4O — CID 20794225
3,3-bis(dimethylamino)-2-(2-methyl-5-oxopyrrolidin-1-yl)propanenitrile (PubChem CID 20794225) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 3,3-bis(dimethylamino)-2-(2-methyl-5-oxopyrrolidin-1-yl)propanenitrile.
| Compound Name | 3,3-bis(dimethylamino)-2-(2-methyl-5-oxopyrrolidin-1-yl)propanenitrile |
|---|---|
| PubChem CID | 20794225 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 3,3-bis(dimethylamino)-2-(2-methyl-5-oxopyrrolidin-1-yl)propanenitrile |
| SMILES | CC1CCC(=O)N1C(C#N)C(N(C)C)N(C)C |
| InChI | InChI=1S/C12H22N4O/c1-9-6-7-11(17)16(9)10(8-13)12(14(2)3)15(4)5/h9-10,12H,6-7H2,1-5H3 |
| InChIKey | SRRGFCOAOCKILI-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|